C13H22N4 — CID 79260107
[2-[(2-ethylpiperidin-1-yl)methyl]-4-pyridinyl]hydrazine (PubChem CID 79260107) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is [2-[(2-ethylpiperidin-1-yl)methyl]-4-pyridinyl]hydrazine.
| Compound Name | [2-[(2-ethylpiperidin-1-yl)methyl]-4-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79260107 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | [2-[(2-ethylpiperidin-1-yl)methyl]-4-pyridinyl]hydrazine |
| SMILES | CCC1CCCCN1Cc1cc(NN)ccn1 |
| InChI | InChI=1S/C13H22N4/c1-2-13-5-3-4-8-17(13)10-12-9-11(16-14)6-7-15-12/h6-7,9,13H,2-5,8,10,14H2,1H3,(H,15,16) |
| InChIKey | CZPPQTICVZSDJX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|