About N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide
N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 79260501) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide.
Molecular Properties
| Compound Name | N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide |
| PubChem CID | 79260501 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)F)Nn1cccc1 |
| InChI | InChI=1S/C8H10F3N3O/c9-8(10,11)6-12-5-7(15)13-14-3-1-2-4-14/h1-4,12H,5-6H2,(H,13,15) |
| InChIKey | JOHLJFGPSKMLFH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide?
The IUPAC name of N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide (CID 79260501) is N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide.
What is the SMILES notation for N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide?
The canonical SMILES for N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide is O=C(CNCC(F)(F)F)Nn1cccc1.
What is the InChIKey of N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide?
The InChIKey is JOHLJFGPSKMLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O/c9-8(10,11)6-12-5-7(15)13-14-3-1-2-4-14/h1-4,12H,5-6H2,(H,13,15).
What are the key properties of N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide?
N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide has a molecular weight of 221.18 g/mol, XLogP of 0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrol-1-yl-2-(2,2,2-trifluoroethylamino)acetamide is sourced from PubChem (CID 79260501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).