C12H25F3N2 — CID 79260502
N-(2,2,2-trifluoroethyl)-N'-(2,4,4-trimethylpentan-2-yl)ethane-1,2-diamine (PubChem CID 79260502) has the molecular formula C12H25F3N2 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-N'-(2,4,4-trimethylpentan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2,2,2-trifluoroethyl)-N'-(2,4,4-trimethylpentan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79260502 |
| Molecular Formula | C12H25F3N2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-N'-(2,4,4-trimethylpentan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)(C)CC(C)(C)NCCNCC(F)(F)F |
| InChI | InChI=1S/C12H25F3N2/c1-10(2,3)8-11(4,5)17-7-6-16-9-12(13,14)15/h16-17H,6-9H2,1-5H3 |
| InChIKey | QDCCLCNJPLJJIY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|