C12H20N2O — CID 79261151
2-[(6-methyl-2-pyridinyl)methyl-propan-2-ylamino]ethanol (PubChem CID 79261151) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-[(6-methyl-2-pyridinyl)methyl-propan-2-ylamino]ethanol.
| Compound Name | 2-[(6-methyl-2-pyridinyl)methyl-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 79261151 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-[(6-methyl-2-pyridinyl)methyl-propan-2-ylamino]ethanol |
| SMILES | Cc1cccc(CN(CCO)C(C)C)n1 |
| InChI | InChI=1S/C12H20N2O/c1-10(2)14(7-8-15)9-12-6-4-5-11(3)13-12/h4-6,10,15H,7-9H2,1-3H3 |
| InChIKey | UAQRJFXCFHEARN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |