About 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid
3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid (PubChem CID 79261449) has the molecular formula C10H17F3N2O3
and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid |
| PubChem CID | 79261449 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-3-15(5-7(2)9(17)18)8(16)4-14-6-10(11,12)13/h7,14H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | XNLJBCBYEWNVFN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid?
The IUPAC name of 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid (CID 79261449) is 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid.
What is the SMILES notation for 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid?
The canonical SMILES for 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid is CCN(CC(C)C(=O)O)C(=O)CNCC(F)(F)F.
What is the InChIKey of 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid?
The InChIKey is XNLJBCBYEWNVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O3/c1-3-15(5-7(2)9(17)18)8(16)4-14-6-10(11,12)13/h7,14H,3-6H2,1-2H3,(H,17,18).
What are the key properties of 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid?
3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid has a molecular weight of 270.25 g/mol, XLogP of 0.71, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]-2-methylpropanoic acid is sourced from PubChem (CID 79261449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).