About 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid
3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid (PubChem CID 79261526) has the molecular formula C11H18F3N3O3
and a molecular weight of 297.28 g/mol. Its IUPAC name is 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid |
| PubChem CID | 79261526 |
| Molecular Formula | C11H18F3N3O3 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(C(=O)CNCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3N3O3/c12-11(13,14)8-15-7-9(18)17-5-3-16(4-6-17)2-1-10(19)20/h15H,1-8H2,(H,19,20) |
| InChIKey | GCOZYUKGLHVGBQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid?
The IUPAC name of 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid (CID 79261526) is 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid?
The canonical SMILES for 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid is O=C(O)CCN1CCN(C(=O)CNCC(F)(F)F)CC1.
What is the InChIKey of 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid?
The InChIKey is GCOZYUKGLHVGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3N3O3/c12-11(13,14)8-15-7-9(18)17-5-3-16(4-6-17)2-1-10(19)20/h15H,1-8H2,(H,19,20).
What are the key properties of 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid?
3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid has a molecular weight of 297.28 g/mol, XLogP of -0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazin-1-yl]propanoic acid is sourced from PubChem (CID 79261526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).