C11H19F3N2 — CID 79261544
N'-(dicyclopropylmethyl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 79261544) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is N'-(dicyclopropylmethyl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-(dicyclopropylmethyl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79261544 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N'-(dicyclopropylmethyl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | FC(F)(F)CNCCNC(C1CC1)C1CC1 |
| InChI | InChI=1S/C11H19F3N2/c12-11(13,14)7-15-5-6-16-10(8-1-2-8)9-3-4-9/h8-10,15-16H,1-7H2 |
| InChIKey | JPWPPFBZYRCGNW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|