C10H14F3N3O3 — CID 79261712
3,3-dimethyl-4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazine-2,6-dione (PubChem CID 79261712) has the molecular formula C10H14F3N3O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 3,3-dimethyl-4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 79261712 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3,3-dimethyl-4-[2-(2,2,2-trifluoroethylamino)acetyl]piperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O3/c1-9(2)8(19)15-6(17)4-16(9)7(18)3-14-5-10(11,12)13/h14H,3-5H2,1-2H3,(H,15,17,19) |
| InChIKey | UNERBJQSULXQEZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|