About 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid
2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid (PubChem CID 79262557) has the molecular formula C11H13N3O5
and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid |
| PubChem CID | 79262557 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C11H13N3O5/c1-2-5-13(7-11(18)19)10(17)6-14-9(16)4-3-8(15)12-14/h2-4H,1,5-7H2,(H,12,15)(H,18,19) |
| InChIKey | APHNBOCWGMDJTM-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid?
The IUPAC name of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid (CID 79262557) is 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid.
What is the SMILES notation for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid?
The canonical SMILES for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid is C=CCN(CC(=O)O)C(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid?
The InChIKey is APHNBOCWGMDJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O5/c1-2-5-13(7-11(18)19)10(17)6-14-9(16)4-3-8(15)12-14/h2-4H,1,5-7H2,(H,12,15)(H,18,19).
What are the key properties of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid?
2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid has a molecular weight of 267.24 g/mol, XLogP of -1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-prop-2-enylamino]acetic acid is sourced from PubChem (CID 79262557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).