About 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione
4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione (PubChem CID 79263145) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione.
Molecular Properties
| Compound Name | 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione |
| PubChem CID | 79263145 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione |
| SMILES | Cc1cccc(CN2C(=O)C(=O)c3c(C)ccc(C)c32)n1 |
| InChI | InChI=1S/C17H16N2O2/c1-10-7-8-11(2)15-14(10)16(20)17(21)19(15)9-13-6-4-5-12(3)18-13/h4-8H,9H2,1-3H3 |
| InChIKey | ILYNYMZYVDVRJU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione?
The IUPAC name of 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione (CID 79263145) is 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione.
What is the SMILES notation for 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione?
The canonical SMILES for 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione is Cc1cccc(CN2C(=O)C(=O)c3c(C)ccc(C)c32)n1.
What is the InChIKey of 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione?
The InChIKey is ILYNYMZYVDVRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-10-7-8-11(2)15-14(10)16(20)17(21)19(15)9-13-6-4-5-12(3)18-13/h4-8H,9H2,1-3H3.
What are the key properties of 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione?
4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione has a molecular weight of 280.33 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]indole-2,3-dione is sourced from PubChem (CID 79263145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).