C12H21N3O4 — CID 79263277
2-[[2-(carbamoylamino)-3-methylpentanoyl]-prop-2-enylamino]acetic acid (PubChem CID 79263277) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)-3-methylpentanoyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-(carbamoylamino)-3-methylpentanoyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79263277 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[[2-(carbamoylamino)-3-methylpentanoyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)C(NC(N)=O)C(C)CC |
| InChI | InChI=1S/C12H21N3O4/c1-4-6-15(7-9(16)17)11(18)10(8(3)5-2)14-12(13)19/h4,8,10H,1,5-7H2,2-3H3,(H,16,17)(H3,13,14,19) |
| InChIKey | QDQLYNIITNKFRH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|