2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid

C9H12F3NO3 — CID 79263559

IUPAC2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid
SMILESC=CCN(CC(=O)O)C(=O)CCC(F)(F)F
InChIInChI=1S/C9H12F3NO3/c1-2-5-13(6-8(15)16)7(14)3-4-9(10,11)12/h2H,1,3-6H2,(H,15,16)
InChIKeyUFAFMXZFJKXKHX-UHFFFAOYSA-N
MW239.19 g/mol
LogP1.43
Rot. Bonds6

About 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid

2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid (PubChem CID 79263559) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid.

Molecular Properties

Compound Name2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid
PubChem CID79263559
Molecular FormulaC9H12F3NO3
Molecular Weight239.19 g/mol
Exact Mass239.08
IUPAC Name2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid
SMILESC=CCN(CC(=O)O)C(=O)CCC(F)(F)F
InChIInChI=1S/C9H12F3NO3/c1-2-5-13(6-8(15)16)7(14)3-4-9(10,11)12/h2H,1,3-6H2,(H,15,16)
InChIKeyUFAFMXZFJKXKHX-UHFFFAOYSA-N
XLogP1.43
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.19
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid?
The IUPAC name of 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid (CID 79263559) is 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid.
What is the SMILES notation for 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid?
The canonical SMILES for 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid is C=CCN(CC(=O)O)C(=O)CCC(F)(F)F.
What is the InChIKey of 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid?
The InChIKey is UFAFMXZFJKXKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO3/c1-2-5-13(6-8(15)16)7(14)3-4-9(10,11)12/h2H,1,3-6H2,(H,15,16).
What are the key properties of 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid?
2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid has a molecular weight of 239.19 g/mol, XLogP of 1.43, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[prop-2-enyl(4,4,4-trifluorobutanoyl)amino]acetic acid is sourced from PubChem (CID 79263559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).