About 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione
6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione (PubChem CID 79264137) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione |
| PubChem CID | 79264137 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione |
| SMILES | Cc1cccc(CN2C(=O)C(C)NC(=O)C2(C)C2CC2)n1 |
| InChI | InChI=1S/C16H21N3O2/c1-10-5-4-6-13(17-10)9-19-14(20)11(2)18-15(21)16(19,3)12-7-8-12/h4-6,11-12H,7-9H2,1-3H3,(H,18,21) |
| InChIKey | XODNFBWIOLBMGG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione?
The IUPAC name of 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione (CID 79264137) is 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione.
What is the SMILES notation for 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione?
The canonical SMILES for 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione is Cc1cccc(CN2C(=O)C(C)NC(=O)C2(C)C2CC2)n1.
What is the InChIKey of 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione?
The InChIKey is XODNFBWIOLBMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-10-5-4-6-13(17-10)9-19-14(20)11(2)18-15(21)16(19,3)12-7-8-12/h4-6,11-12H,7-9H2,1-3H3,(H,18,21).
What are the key properties of 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione?
6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione has a molecular weight of 287.36 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-3,6-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]piperazine-2,5-dione is sourced from PubChem (CID 79264137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).