C10H7Cl2F3N4OS — CID 79264365
N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 79264365) has the molecular formula C10H7Cl2F3N4OS and a molecular weight of 359.16 g/mol. Its IUPAC name is N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 79264365 |
| Molecular Formula | C10H7Cl2F3N4OS |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)F)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C10H7Cl2F3N4OS/c11-4-1-5(12)8-9(19-21-18-8)7(4)17-6(20)2-16-3-10(13,14)15/h1,16H,2-3H2,(H,17,20) |
| InChIKey | CYGUVXFTTVEGGJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |