C16H24N2O3 — CID 79264465
2-[tert-butyl-[2-(3-methylphenyl)ethylcarbamoyl]amino]acetic acid (PubChem CID 79264465) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[tert-butyl-[2-(3-methylphenyl)ethylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[2-(3-methylphenyl)ethylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 79264465 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-[tert-butyl-[2-(3-methylphenyl)ethylcarbamoyl]amino]acetic acid |
| SMILES | Cc1cccc(CCNC(=O)N(CC(=O)O)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-12-6-5-7-13(10-12)8-9-17-15(21)18(11-14(19)20)16(2,3)4/h5-7,10H,8-9,11H2,1-4H3,(H,17,21)(H,19,20) |
| InChIKey | HVTJEXTZTMNFMD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |