C8H10N4O4 — CID 79264605
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)-prop-2-enylamino]acetic acid (PubChem CID 79264605) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79264605 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)c1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10N4O4/c1-2-3-12(4-5(13)14)6-7(15)9-8(16)11-10-6/h2H,1,3-4H2,(H,13,14)(H2,9,11,15,16) |
| InChIKey | NVFRWDGDVNRDPF-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|