C10H14F3N5O3 — CID 79264662
2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79264662) has the molecular formula C10H14F3N5O3 and a molecular weight of 309.25 g/mol. Its IUPAC name is 2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79264662 |
| Molecular Formula | C10H14F3N5O3 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H14F3N5O3/c11-10(12,13)5-18(4-8(19)20)9(21)14-3-1-2-7-15-6-16-17-7/h6H,1-5H2,(H,14,21)(H,19,20)(H,15,16,17) |
| InChIKey | WYUJRVTULARJPS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|