C11H8F3I2NO4 — CID 79264834
2-[(2-hydroxy-3,5-diiodobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79264834) has the molecular formula C11H8F3I2NO4 and a molecular weight of 528.99 g/mol. Its IUPAC name is 2-[(2-hydroxy-3,5-diiodobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(2-hydroxy-3,5-diiodobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79264834 |
| Molecular Formula | C11H8F3I2NO4 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.85 |
| IUPAC Name | 2-[(2-hydroxy-3,5-diiodobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C11H8F3I2NO4/c12-11(13,14)4-17(3-8(18)19)10(21)6-1-5(15)2-7(16)9(6)20/h1-2,20H,3-4H2,(H,18,19) |
| InChIKey | KENPXDIWWNZBGP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|