C10H12F3N3O5 — CID 79265249
2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79265249) has the molecular formula C10H12F3N3O5 and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79265249 |
| Molecular Formula | C10H12F3N3O5 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CN1CC(=O)N(CC(=O)N(CC(=O)O)CC(F)(F)F)C1=O |
| InChI | InChI=1S/C10H12F3N3O5/c1-14-2-7(18)16(9(14)21)3-6(17)15(4-8(19)20)5-10(11,12)13/h2-5H2,1H3,(H,19,20) |
| InChIKey | MIXHYTYCBQLUKU-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|