C12H14F3NO4 — CID 79266512
2-[1-(2,5-dihydroxyphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79266512) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 2-[1-(2,5-dihydroxyphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[1-(2,5-dihydroxyphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79266512 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[1-(2,5-dihydroxyphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CC(c1cc(O)ccc1O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO4/c1-7(9-4-8(17)2-3-10(9)18)16(5-11(19)20)6-12(13,14)15/h2-4,7,17-18H,5-6H2,1H3,(H,19,20) |
| InChIKey | OZHJPRRQZQFJFC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|