About 4-[(3,4-difluorophenyl)methyl]thiomorpholine
4-[(3,4-difluorophenyl)methyl]thiomorpholine (PubChem CID 792677) has the molecular formula C11H13F2NS
and a molecular weight of 229.29 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl]thiomorpholine.
Molecular Properties
| Compound Name | 4-[(3,4-difluorophenyl)methyl]thiomorpholine |
| PubChem CID | 792677 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl]thiomorpholine |
| SMILES | Fc1ccc(CN2CCSCC2)cc1F |
| InChI | InChI=1S/C11H13F2NS/c12-10-2-1-9(7-11(10)13)8-14-3-5-15-6-4-14/h1-2,7H,3-6,8H2 |
| InChIKey | MSQZYJIPOLUJHP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,4-difluorophenyl)methyl]thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-difluorophenyl)methyl]thiomorpholine?
The IUPAC name of 4-[(3,4-difluorophenyl)methyl]thiomorpholine (CID 792677) is 4-[(3,4-difluorophenyl)methyl]thiomorpholine.
What is the SMILES notation for 4-[(3,4-difluorophenyl)methyl]thiomorpholine?
The canonical SMILES for 4-[(3,4-difluorophenyl)methyl]thiomorpholine is Fc1ccc(CN2CCSCC2)cc1F.
What is the InChIKey of 4-[(3,4-difluorophenyl)methyl]thiomorpholine?
The InChIKey is MSQZYJIPOLUJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NS/c12-10-2-1-9(7-11(10)13)8-14-3-5-15-6-4-14/h1-2,7H,3-6,8H2.
What are the key properties of 4-[(3,4-difluorophenyl)methyl]thiomorpholine?
4-[(3,4-difluorophenyl)methyl]thiomorpholine has a molecular weight of 229.29 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-difluorophenyl)methyl]thiomorpholine is sourced from PubChem (CID 792677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).