C12H20N2O3 — CID 79269384
2-[tert-butyl-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]acetic acid (PubChem CID 79269384) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[tert-butyl-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 79269384 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-[tert-butyl-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]amino]acetic acid |
| SMILES | C#CCNC(=O)C(C)N(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-6-7-13-11(17)9(2)14(8-10(15)16)12(3,4)5/h1,9H,7-8H2,2-5H3,(H,13,17)(H,15,16) |
| InChIKey | IXWFIPVANCVDBV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|