About 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid
2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79269471) has the molecular formula C8H14F3NO2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid |
| PubChem CID | 79269471 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CC(C)(C)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-7(2,3)12(4-6(13)14)5-8(9,10)11/h4-5H2,1-3H3,(H,13,14) |
| InChIKey | HQABFKRJVNJHKS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
The IUPAC name of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid (CID 79269471) is 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid is CC(C)(C)N(CC(=O)O)CC(F)(F)F.
What is the InChIKey of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
The InChIKey is HQABFKRJVNJHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2/c1-7(2,3)12(4-6(13)14)5-8(9,10)11/h4-5H2,1-3H3,(H,13,14).
What are the key properties of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid has a molecular weight of 213.20 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid is sourced from PubChem (CID 79269471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).