2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid

C8H14F3NO2 — CID 79269471

IUPAC2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid
SMILESCC(C)(C)N(CC(=O)O)CC(F)(F)F
InChIInChI=1S/C8H14F3NO2/c1-7(2,3)12(4-6(13)14)5-8(9,10)11/h4-5H2,1-3H3,(H,13,14)
InChIKeyHQABFKRJVNJHKS-UHFFFAOYSA-N
MW213.20 g/mol
LogP1.73
Rot. Bonds3

About 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid

2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79269471) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid
PubChem CID79269471
Molecular FormulaC8H14F3NO2
Molecular Weight213.20 g/mol
Exact Mass213.10
IUPAC Name2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid
SMILESCC(C)(C)N(CC(=O)O)CC(F)(F)F
InChIInChI=1S/C8H14F3NO2/c1-7(2,3)12(4-6(13)14)5-8(9,10)11/h4-5H2,1-3H3,(H,13,14)
InChIKeyHQABFKRJVNJHKS-UHFFFAOYSA-N
XLogP1.73
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.20
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
The IUPAC name of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid (CID 79269471) is 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid is CC(C)(C)N(CC(=O)O)CC(F)(F)F.
What is the InChIKey of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
The InChIKey is HQABFKRJVNJHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2/c1-7(2,3)12(4-6(13)14)5-8(9,10)11/h4-5H2,1-3H3,(H,13,14).
What are the key properties of 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid?
2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid has a molecular weight of 213.20 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(2,2,2-trifluoroethyl)amino]acetic acid is sourced from PubChem (CID 79269471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).