About oxolan-3-yl 2-(2-methoxyethylamino)acetate
oxolan-3-yl 2-(2-methoxyethylamino)acetate (PubChem CID 79270563) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is oxolan-3-yl 2-(2-methoxyethylamino)acetate.
Molecular Properties
| Compound Name | oxolan-3-yl 2-(2-methoxyethylamino)acetate |
| PubChem CID | 79270563 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | oxolan-3-yl 2-(2-methoxyethylamino)acetate |
| SMILES | COCCNCC(=O)OC1CCOC1 |
| InChI | InChI=1S/C9H17NO4/c1-12-5-3-10-6-9(11)14-8-2-4-13-7-8/h8,10H,2-7H2,1H3 |
| InChIKey | MAXVGUZBYDSMCK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl 2-(2-methoxyethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 2-(2-methoxyethylamino)acetate?
The IUPAC name of oxolan-3-yl 2-(2-methoxyethylamino)acetate (CID 79270563) is oxolan-3-yl 2-(2-methoxyethylamino)acetate.
What is the SMILES notation for oxolan-3-yl 2-(2-methoxyethylamino)acetate?
The canonical SMILES for oxolan-3-yl 2-(2-methoxyethylamino)acetate is COCCNCC(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 2-(2-methoxyethylamino)acetate?
The InChIKey is MAXVGUZBYDSMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-12-5-3-10-6-9(11)14-8-2-4-13-7-8/h8,10H,2-7H2,1H3.
What are the key properties of oxolan-3-yl 2-(2-methoxyethylamino)acetate?
oxolan-3-yl 2-(2-methoxyethylamino)acetate has a molecular weight of 203.24 g/mol, XLogP of -0.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2-(2-methoxyethylamino)acetate is sourced from PubChem (CID 79270563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).