C21H16F3N3O — CID 7927071
N-(4-phenyldiazenylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 7927071) has the molecular formula C21H16F3N3O and a molecular weight of 383.37 g/mol. Its IUPAC name is N-(4-phenyldiazenylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(4-phenyldiazenylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7927071 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(4-phenyldiazenylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16F3N3O/c22-21(23,24)16-6-4-5-15(13-16)14-20(28)25-17-9-11-19(12-10-17)27-26-18-7-2-1-3-8-18/h1-13H,14H2,(H,25,28)/b27-26+ |
| InChIKey | RVNACVPXOXECDR-CYYJNZCTSA-N |
| XLogP | 6.30 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|