C23H22N4O3 — CID 7927098
3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenyldiazenylphenyl)propanamide (PubChem CID 7927098) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenyldiazenylphenyl)propanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenyldiazenylphenyl)propanamide |
|---|---|
| PubChem CID | 7927098 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenyldiazenylphenyl)propanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c28-21(14-15-27-22(29)19-8-4-5-9-20(19)23(27)30)24-16-10-12-18(13-11-16)26-25-17-6-2-1-3-7-17/h1-7,10-13,19-20H,8-9,14-15H2,(H,24,28)/b26-25+/t19-,20-/m1/s1 |
| InChIKey | ZQXFTRYODKOCGI-XDKAXSIESA-N |
| XLogP | 4.38 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|