C23H24N2O4 — CID 7927150
N',N'-diphenyl-2-(3,4,5-trimethoxyphenyl)acetohydrazide (PubChem CID 7927150) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N',N'-diphenyl-2-(3,4,5-trimethoxyphenyl)acetohydrazide.
| Compound Name | N',N'-diphenyl-2-(3,4,5-trimethoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 7927150 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N',N'-diphenyl-2-(3,4,5-trimethoxyphenyl)acetohydrazide |
| SMILES | COc1cc(CC(=O)NN(c2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O4/c1-27-20-14-17(15-21(28-2)23(20)29-3)16-22(26)24-25(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15H,16H2,1-3H3,(H,24,26) |
| InChIKey | UPDHWVZOAZWZQQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|