C16H14F2N2O — CID 79272240
7,8-difluoro-6-phenyl-1,3,4,5-tetrahydro-1,6-benzodiazocin-2-one (PubChem CID 79272240) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 7,8-difluoro-6-phenyl-1,3,4,5-tetrahydro-1,6-benzodiazocin-2-one.
| Compound Name | 7,8-difluoro-6-phenyl-1,3,4,5-tetrahydro-1,6-benzodiazocin-2-one |
|---|---|
| PubChem CID | 79272240 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 7,8-difluoro-6-phenyl-1,3,4,5-tetrahydro-1,6-benzodiazocin-2-one |
| SMILES | O=C1CCCN(c2ccccc2)c2c(ccc(F)c2F)N1 |
| InChI | InChI=1S/C16H14F2N2O/c17-12-8-9-13-16(15(12)18)20(10-4-7-14(21)19-13)11-5-2-1-3-6-11/h1-3,5-6,8-9H,4,7,10H2,(H,19,21) |
| InChIKey | AJTPSZJDXDSSCF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |