About 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione
1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 79272608) has the molecular formula C14H12ClN3O2S
and a molecular weight of 321.79 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione.
Molecular Properties
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione |
| PubChem CID | 79272608 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | COc1cc(OC)c(-n2c(=S)[nH]c3cnccc32)cc1Cl |
| InChI | InChI=1S/C14H12ClN3O2S/c1-19-12-6-13(20-2)11(5-8(12)15)18-10-3-4-16-7-9(10)17-14(18)21/h3-7H,1-2H3,(H,17,21) |
| InChIKey | ZVRIFAMLOPHUQI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione?
The IUPAC name of 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione (CID 79272608) is 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione.
What is the SMILES notation for 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione?
The canonical SMILES for 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione is COc1cc(OC)c(-n2c(=S)[nH]c3cnccc32)cc1Cl.
What is the InChIKey of 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione?
The InChIKey is ZVRIFAMLOPHUQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3O2S/c1-19-12-6-13(20-2)11(5-8(12)15)18-10-3-4-16-7-9(10)17-14(18)21/h3-7H,1-2H3,(H,17,21).
What are the key properties of 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione?
1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione has a molecular weight of 321.79 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2,4-dimethoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione is sourced from PubChem (CID 79272608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).