C15H13Cl2N3O — CID 79273787
2-(2-chloroethyl)-1-(3-chloro-4-methoxyphenyl)imidazo[4,5-c]pyridine (PubChem CID 79273787) has the molecular formula C15H13Cl2N3O and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(3-chloro-4-methoxyphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chloroethyl)-1-(3-chloro-4-methoxyphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79273787 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-(2-chloroethyl)-1-(3-chloro-4-methoxyphenyl)imidazo[4,5-c]pyridine |
| SMILES | COc1ccc(-n2c(CCCl)nc3cnccc32)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O/c1-21-14-3-2-10(8-11(14)17)20-13-5-7-18-9-12(13)19-15(20)4-6-16/h2-3,5,7-9H,4,6H2,1H3 |
| InChIKey | XNKVAQIYBPRSMT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|