About 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine
1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine (PubChem CID 79274986) has the molecular formula C16H15BrClN3
and a molecular weight of 364.67 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine |
| PubChem CID | 79274986 |
| Molecular Formula | C16H15BrClN3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine |
| SMILES | Cc1cc(Br)cc(C)c1-n1c(C(C)Cl)nc2cnccc21 |
| InChI | InChI=1S/C16H15BrClN3/c1-9-6-12(17)7-10(2)15(9)21-14-4-5-19-8-13(14)20-16(21)11(3)18/h4-8,11H,1-3H3 |
| InChIKey | NXWZOXHQQVWMSJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine?
The IUPAC name of 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine (CID 79274986) is 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine.
What is the SMILES notation for 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine?
The canonical SMILES for 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine is Cc1cc(Br)cc(C)c1-n1c(C(C)Cl)nc2cnccc21.
What is the InChIKey of 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine?
The InChIKey is NXWZOXHQQVWMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrClN3/c1-9-6-12(17)7-10(2)15(9)21-14-4-5-19-8-13(14)20-16(21)11(3)18/h4-8,11H,1-3H3.
What are the key properties of 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine?
1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine has a molecular weight of 364.67 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,6-dimethylphenyl)-2-(1-chloroethyl)imidazo[4,5-c]pyridine is sourced from PubChem (CID 79274986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).