C9H13F3N2O3 — CID 79275747
2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetic acid (PubChem CID 79275747) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79275747 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3/c1-2-3-14(5-8(16)17)4-7(15)13-6-9(10,11)12/h2H,1,3-6H2,(H,13,15)(H,16,17) |
| InChIKey | OJESKQYKPCYZGW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|