C13H16ClN5O2 — CID 79275826
3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]piperidine-2,6-dione (PubChem CID 79275826) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 79275826 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]piperidine-2,6-dione |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16ClN5O2/c1-7-11-13(18(2)17-7)19(9(15-11)5-6-14)8-3-4-10(20)16-12(8)21/h8H,3-6H2,1-2H3,(H,16,20,21) |
| InChIKey | FXEGBQQSCGQVSO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|