C13H16ClN5O2 — CID 79275828
3-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidine-2,6-dione (PubChem CID 79275828) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 3-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79275828 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidine-2,6-dione |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2C1CCC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H16ClN5O2/c1-7-11-12(18(3)16-7)19(9(6-14)15-11)8-4-5-10(20)17(2)13(8)21/h8H,4-6H2,1-3H3 |
| InChIKey | CJSIRMCYPSRAOW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|