C15H22ClN5 — CID 79276693
5-(2-chloroethyl)-6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-dimethylimidazo[4,5-d]pyrazole (PubChem CID 79276693) has the molecular formula C15H22ClN5 and a molecular weight of 307.83 g/mol. Its IUPAC name is 5-(2-chloroethyl)-6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-dimethylimidazo[4,5-d]pyrazole.
| Compound Name | 5-(2-chloroethyl)-6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-dimethylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79276693 |
| Molecular Formula | C15H22ClN5 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 5-(2-chloroethyl)-6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-dimethylimidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2C1CCN2CCCC12 |
| InChI | InChI=1S/C15H22ClN5/c1-10-14-15(19(2)18-10)21(13(17-14)5-7-16)12-6-9-20-8-3-4-11(12)20/h11-12H,3-9H2,1-2H3 |
| InChIKey | PCLUOCPETLRHKB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|