About 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one
5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one (PubChem CID 79276862) has the molecular formula C14H20ClN5O
and a molecular weight of 309.80 g/mol. Its IUPAC name is 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one |
| PubChem CID | 79276862 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2C1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C14H20ClN5O/c1-9-13-14(19(3)17-9)20(11(16-13)6-7-15)10-4-5-12(21)18(2)8-10/h10H,4-8H2,1-3H3 |
| InChIKey | CFCAMGYVNTWYEU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one?
The IUPAC name of 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one (CID 79276862) is 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one is Cc1nn(C)c2c1nc(CCCl)n2C1CCC(=O)N(C)C1.
What is the InChIKey of 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one?
The InChIKey is CFCAMGYVNTWYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN5O/c1-9-13-14(19(3)17-9)20(11(16-13)6-7-15)10-4-5-12(21)18(2)8-10/h10H,4-8H2,1-3H3.
What are the key properties of 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one?
5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one has a molecular weight of 309.80 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-1-methylpiperidin-2-one is sourced from PubChem (CID 79276862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).