About 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine
3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79277003) has the molecular formula C14H12N4O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 79277003 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccnc2c1nc(N)n2-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N4O2/c1-8-4-5-16-13-12(8)17-14(15)18(13)9-2-3-10-11(6-9)20-7-19-10/h2-6H,7H2,1H3,(H2,15,17) |
| InChIKey | NAIBTNHRPHJVRB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine (CID 79277003) is 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine is Cc1ccnc2c1nc(N)n2-c1ccc2c(c1)OCO2.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine?
The InChIKey is NAIBTNHRPHJVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2/c1-8-4-5-16-13-12(8)17-14(15)18(13)9-2-3-10-11(6-9)20-7-19-10/h2-6H,7H2,1H3,(H2,15,17).
What are the key properties of 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine?
3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine has a molecular weight of 268.28 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-7-methylimidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 79277003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).