C12H20N2O4 — CID 79277104
2-[[2-(oxan-4-ylamino)-2-oxoethyl]-prop-2-enylamino]acetic acid (PubChem CID 79277104) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[[2-(oxan-4-ylamino)-2-oxoethyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-(oxan-4-ylamino)-2-oxoethyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79277104 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[[2-(oxan-4-ylamino)-2-oxoethyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)CC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C12H20N2O4/c1-2-5-14(9-12(16)17)8-11(15)13-10-3-6-18-7-4-10/h2,10H,1,3-9H2,(H,13,15)(H,16,17) |
| InChIKey | ULDXWAGQLONPIE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|