C16H15N3OS — CID 79277586
3-(3,4-dihydro-2H-chromen-4-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79277586) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79277586 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1ccnc2c1[nH]c(=S)n2C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H15N3OS/c1-10-6-8-17-15-14(10)18-16(21)19(15)12-7-9-20-13-5-3-2-4-11(12)13/h2-6,8,12H,7,9H2,1H3,(H,18,21) |
| InChIKey | QLVCWSOHDOFLPB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|