C10H16F3N3O2 — CID 79277930
N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(prop-2-enylamino)acetamide (PubChem CID 79277930) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79277930 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)N(C)CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O2/c1-3-4-14-5-9(18)16(2)6-8(17)15-7-10(11,12)13/h3,14H,1,4-7H2,2H3,(H,15,17) |
| InChIKey | WFNXJFQIPYCEFI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|