C11H15F3N2O3 — CID 79278023
1-[2-(prop-2-enylamino)acetyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 79278023) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-[2-(prop-2-enylamino)acetyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(prop-2-enylamino)acetyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79278023 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[2-(prop-2-enylamino)acetyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=CCNCC(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F3N2O3/c1-2-4-15-6-8(17)16-5-3-10(7-16,9(18)19)11(12,13)14/h2,15H,1,3-7H2,(H,18,19) |
| InChIKey | XNWSLTKFCJCROX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|