About 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide
4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide (PubChem CID 79278162) has the molecular formula C14H18ClN3O2S
and a molecular weight of 327.84 g/mol. Its IUPAC name is 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
| PubChem CID | 79278162 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
| SMILES | Cc1cnc2c(c1)nc(C(C)Cl)n2C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18ClN3O2S/c1-9-7-12-14(16-8-9)18(13(17-12)10(2)15)11-3-5-21(19,20)6-4-11/h7-8,10-11H,3-6H2,1-2H3 |
| InChIKey | QTKDGCGWOITOBV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide?
The IUPAC name of 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide (CID 79278162) is 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide.
What is the SMILES notation for 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide?
The canonical SMILES for 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide is Cc1cnc2c(c1)nc(C(C)Cl)n2C1CCS(=O)(=O)CC1.
What is the InChIKey of 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide?
The InChIKey is QTKDGCGWOITOBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O2S/c1-9-7-12-14(16-8-9)18(13(17-12)10(2)15)11-3-5-21(19,20)6-4-11/h7-8,10-11H,3-6H2,1-2H3.
What are the key properties of 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide?
4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide has a molecular weight of 327.84 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide is sourced from PubChem (CID 79278162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).