C13H11F3N4S — CID 79278290
3-ethyl-1-methyl-6-(3,4,5-trifluorophenyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79278290) has the molecular formula C13H11F3N4S and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-(3,4,5-trifluorophenyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 3-ethyl-1-methyl-6-(3,4,5-trifluorophenyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79278290 |
| Molecular Formula | C13H11F3N4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-ethyl-1-methyl-6-(3,4,5-trifluorophenyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H11F3N4S/c1-3-9-11-12(19(2)18-9)20(13(21)17-11)6-4-7(14)10(16)8(15)5-6/h4-5H,3H2,1-2H3,(H,17,21) |
| InChIKey | OWWVAFZMWSGGSC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|