C12H25N3O — CID 79278726
N-[1-(diethylamino)propan-2-yl]-2-(prop-2-enylamino)acetamide (PubChem CID 79278726) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[1-(diethylamino)propan-2-yl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-[1-(diethylamino)propan-2-yl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79278726 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N-[1-(diethylamino)propan-2-yl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)NC(C)CN(CC)CC |
| InChI | InChI=1S/C12H25N3O/c1-5-8-13-9-12(16)14-11(4)10-15(6-2)7-3/h5,11,13H,1,6-10H2,2-4H3,(H,14,16) |
| InChIKey | UBXZXOAJMGEOEG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|