C10H17N5O — CID 79278968
N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2-(prop-2-enylamino)acetamide (PubChem CID 79278968) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79278968 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)N(C)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C10H17N5O/c1-4-5-11-6-10(16)15(3)7-9-12-8(2)13-14-9/h4,11H,1,5-7H2,2-3H3,(H,12,13,14) |
| InChIKey | SYYHMNSSHDWMGL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|