C15H18ClN5 — CID 79279788
2-(chloromethyl)-7-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]imidazo[4,5-b]pyridine (PubChem CID 79279788) has the molecular formula C15H18ClN5 and a molecular weight of 303.80 g/mol. Its IUPAC name is 2-(chloromethyl)-7-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-(chloromethyl)-7-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79279788 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-(chloromethyl)-7-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]imidazo[4,5-b]pyridine |
| SMILES | Cc1nn(C)c(C)c1Cn1c(CCl)nc2c(C)ccnc21 |
| InChI | InChI=1S/C15H18ClN5/c1-9-5-6-17-15-14(9)18-13(7-16)21(15)8-12-10(2)19-20(4)11(12)3/h5-6H,7-8H2,1-4H3 |
| InChIKey | AWEJCPAVFSXZSS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|