About N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide (PubChem CID 79280507) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide.
Molecular Properties
| Compound Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide |
| PubChem CID | 79280507 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)NCc1nc(C)no1 |
| InChI | InChI=1S/C9H14N4O2/c1-3-4-10-5-8(14)11-6-9-12-7(2)13-15-9/h3,10H,1,4-6H2,2H3,(H,11,14) |
| InChIKey | YPNOGXXYNOEJGW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide?
The IUPAC name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide (CID 79280507) is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide.
What is the SMILES notation for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide?
The canonical SMILES for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide is C=CCNCC(=O)NCc1nc(C)no1.
What is the InChIKey of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide?
The InChIKey is YPNOGXXYNOEJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-3-4-10-5-8(14)11-6-9-12-7(2)13-15-9/h3,10H,1,4-6H2,2H3,(H,11,14).
What are the key properties of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide?
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide has a molecular weight of 210.24 g/mol, XLogP of -0.23, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(prop-2-enylamino)acetamide is sourced from PubChem (CID 79280507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).