C15H14ClN5 — CID 79281006
3-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]benzonitrile (PubChem CID 79281006) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is 3-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]benzonitrile.
| Compound Name | 3-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]benzonitrile |
|---|---|
| PubChem CID | 79281006 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]benzonitrile |
| SMILES | CCc1nn(C)c2c1nc(CCl)n2-c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H14ClN5/c1-3-12-14-15(20(2)19-12)21(13(8-16)18-14)11-6-4-5-10(7-11)9-17/h4-7H,3,8H2,1-2H3 |
| InChIKey | UNCIUUPBSYKFQA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|