About 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole
5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole (PubChem CID 79281695) has the molecular formula C13H21ClN4O2S
and a molecular weight of 332.86 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole.
Molecular Properties
| Compound Name | 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole |
| PubChem CID | 79281695 |
| Molecular Formula | C13H21ClN4O2S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole |
| SMILES | CCc1nn(C)c2c1nc(C(C)Cl)n2C(C)CS(C)(=O)=O |
| InChI | InChI=1S/C13H21ClN4O2S/c1-6-10-11-13(17(4)16-10)18(12(15-11)9(3)14)8(2)7-21(5,19)20/h8-9H,6-7H2,1-5H3 |
| InChIKey | LLASXPQQSZGTMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole?
The IUPAC name of 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole (CID 79281695) is 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole.
What is the SMILES notation for 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole?
The canonical SMILES for 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole is CCc1nn(C)c2c1nc(C(C)Cl)n2C(C)CS(C)(=O)=O.
What is the InChIKey of 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole?
The InChIKey is LLASXPQQSZGTMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN4O2S/c1-6-10-11-13(17(4)16-10)18(12(15-11)9(3)14)8(2)7-21(5,19)20/h8-9H,6-7H2,1-5H3.
What are the key properties of 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole?
5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole has a molecular weight of 332.86 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(1-methylsulfonylpropan-2-yl)imidazo[4,5-d]pyrazole is sourced from PubChem (CID 79281695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).