C8H17N3O3 — CID 79281885
N-(2-amino-2-oxoethyl)-2-(2-methoxyethylamino)-N-methylacetamide (PubChem CID 79281885) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-(2-methoxyethylamino)-N-methylacetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-(2-methoxyethylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 79281885 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-(2-methoxyethylamino)-N-methylacetamide |
| SMILES | COCCNCC(=O)N(C)CC(N)=O |
| InChI | InChI=1S/C8H17N3O3/c1-11(6-7(9)12)8(13)5-10-3-4-14-2/h10H,3-6H2,1-2H3,(H2,9,12) |
| InChIKey | LAXBITBNBZREQG-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|